C18H17O2P — CID 139231827
6-(3-methylpenta-1,2-dienyl)benzo[c][2,1]benzoxaphosphinine 6-oxide (PubChem CID 139231827) has the molecular formula C18H17O2P and a molecular weight of 296.31 g/mol. Its IUPAC name is 6-(3-methylpenta-1,2-dienyl)benzo[c][2,1]benzoxaphosphinine 6-oxide.
| Compound Name | 6-(3-methylpenta-1,2-dienyl)benzo[c][2,1]benzoxaphosphinine 6-oxide |
|---|---|
| PubChem CID | 139231827 |
| Molecular Formula | C18H17O2P |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 6-(3-methylpenta-1,2-dienyl)benzo[c][2,1]benzoxaphosphinine 6-oxide |
| SMILES | CCC(C)=C=CP1(=O)Oc2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C18H17O2P/c1-3-14(2)12-13-21(19)18-11-7-5-9-16(18)15-8-4-6-10-17(15)20-21/h4-11,13H,3H2,1-2H3 |
| InChIKey | MUKRNLVGGWSGAS-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|