C36H43ClN4O4 — CID 173382991
11-[3-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]propylidene]-5-[2-(2-morpholin-4-ylethylamino)oxyethyl]benzo[c][1]benzazepin-6-one (PubChem CID 173382991) has the molecular formula C36H43ClN4O4 and a molecular weight of 631.22 g/mol. Its IUPAC name is 11-[3-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]propylidene]-5-[2-(2-morpholin-4-ylethylamino)oxyethyl]benzo[c][1]benzazepin-6-one.
| Compound Name | 11-[3-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]propylidene]-5-[2-(2-morpholin-4-ylethylamino)oxyethyl]benzo[c][1]benzazepin-6-one |
|---|---|
| PubChem CID | 173382991 |
| Molecular Formula | C36H43ClN4O4 |
| Molecular Weight | 631.22 g/mol |
| Exact Mass | 630.30 |
| IUPAC Name | 11-[3-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]propylidene]-5-[2-(2-morpholin-4-ylethylamino)oxyethyl]benzo[c][1]benzazepin-6-one |
| SMILES | O=C1c2ccccc2C(=CCCN2CCC(O)(c3ccc(Cl)cc3)CC2)c2ccccc2N1CCONCCN1CCOCC1 |
| InChI | InChI=1S/C36H43ClN4O4/c37-29-13-11-28(12-14-29)36(43)15-19-39(20-16-36)18-5-9-30-31-6-1-2-8-33(31)35(42)41(34-10-4-3-7-32(30)34)24-27-45-38-17-21-40-22-25-44-26-23-40/h1-4,6-14,38,43H,5,15-27H2 |
| InChIKey | TWTQLGDJFLTODK-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 77.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.22 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|