C21H24Si — CID 173383435
(3-benzyl-4-propylcyclopenta-1,3-dien-1-yl)-phenylsilane (PubChem CID 173383435) has the molecular formula C21H24Si and a molecular weight of 304.51 g/mol. Its IUPAC name is (3-benzyl-4-propylcyclopenta-1,3-dien-1-yl)-phenylsilane.
| Compound Name | (3-benzyl-4-propylcyclopenta-1,3-dien-1-yl)-phenylsilane |
|---|---|
| PubChem CID | 173383435 |
| Molecular Formula | C21H24Si |
| Molecular Weight | 304.51 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | (3-benzyl-4-propylcyclopenta-1,3-dien-1-yl)-phenylsilane |
| SMILES | CCCC1=C(Cc2ccccc2)C=C([SiH2]c2ccccc2)C1 |
| InChI | InChI=1S/C21H24Si/c1-2-9-18-15-21(22-20-12-7-4-8-13-20)16-19(18)14-17-10-5-3-6-11-17/h3-8,10-13,16H,2,9,14-15,22H2,1H3 |
| InChIKey | GZVVIIQDPYLKMK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|