C13H15N3O6 — CID 173385497
(4R)-4-amino-5-[5-(C-carbamoyl-N-hydroxycarbonimidoyl)-2-hydroxyphenyl]-5-oxopentanoic acid (PubChem CID 173385497) has the molecular formula C13H15N3O6 and a molecular weight of 309.28 g/mol. Its IUPAC name is (4R)-4-amino-5-[5-(C-carbamoyl-N-hydroxycarbonimidoyl)-2-hydroxyphenyl]-5-oxopentanoic acid.
| Compound Name | (4R)-4-amino-5-[5-(C-carbamoyl-N-hydroxycarbonimidoyl)-2-hydroxyphenyl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 173385497 |
| Molecular Formula | C13H15N3O6 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (4R)-4-amino-5-[5-(C-carbamoyl-N-hydroxycarbonimidoyl)-2-hydroxyphenyl]-5-oxopentanoic acid |
| SMILES | NC(=O)C(=NO)c1ccc(O)c(C(=O)[C@H](N)CCC(=O)O)c1 |
| InChI | InChI=1S/C13H15N3O6/c14-8(2-4-10(18)19)12(20)7-5-6(1-3-9(7)17)11(16-22)13(15)21/h1,3,5,8,17,22H,2,4,14H2,(H2,15,21)(H,18,19)/t8-/m1/s1 |
| InChIKey | MCAGKLPEEPGHNE-MRVPVSSYSA-N |
| XLogP | -0.57 |
| TPSA | 176.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|