C13H15N3O6 — CID 173408629
4-amino-5-[4-(C-carbamoyl-N-hydroxycarbonimidoyl)phenoxy]-5-oxopentanoic acid (PubChem CID 173408629) has the molecular formula C13H15N3O6 and a molecular weight of 309.28 g/mol. Its IUPAC name is 4-amino-5-[4-(C-carbamoyl-N-hydroxycarbonimidoyl)phenoxy]-5-oxopentanoic acid.
| Compound Name | 4-amino-5-[4-(C-carbamoyl-N-hydroxycarbonimidoyl)phenoxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 173408629 |
| Molecular Formula | C13H15N3O6 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 4-amino-5-[4-(C-carbamoyl-N-hydroxycarbonimidoyl)phenoxy]-5-oxopentanoic acid |
| SMILES | NC(=O)C(=NO)c1ccc(OC(=O)C(N)CCC(=O)O)cc1 |
| InChI | InChI=1S/C13H15N3O6/c14-9(5-6-10(17)18)13(20)22-8-3-1-7(2-4-8)11(16-21)12(15)19/h1-4,9,21H,5-6,14H2,(H2,15,19)(H,17,18) |
| InChIKey | YKZBGVQIGOJEES-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 165.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|