About 4-propoxyhex-1-enyl hypofluorite
4-propoxyhex-1-enyl hypofluorite (PubChem CID 173387860) has the molecular formula C9H17FO2
and a molecular weight of 176.23 g/mol. Its IUPAC name is 4-propoxyhex-1-enyl hypofluorite.
Molecular Properties
| Compound Name | 4-propoxyhex-1-enyl hypofluorite |
| PubChem CID | 173387860 |
| Molecular Formula | C9H17FO2 |
| Molecular Weight | 176.23 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 4-propoxyhex-1-enyl hypofluorite |
| SMILES | CCCOC(CC)CC=COF |
| InChI | InChI=1S/C9H17FO2/c1-3-7-11-9(4-2)6-5-8-12-10/h5,8-9H,3-4,6-7H2,1-2H3 |
| InChIKey | FBMYLMBASFWKSH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.23 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 4-propoxyhex-1-enyl hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propoxyhex-1-enyl hypofluorite?
The IUPAC name of 4-propoxyhex-1-enyl hypofluorite (CID 173387860) is 4-propoxyhex-1-enyl hypofluorite.
What is the SMILES notation for 4-propoxyhex-1-enyl hypofluorite?
The canonical SMILES for 4-propoxyhex-1-enyl hypofluorite is CCCOC(CC)CC=COF.
What is the InChIKey of 4-propoxyhex-1-enyl hypofluorite?
The InChIKey is FBMYLMBASFWKSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17FO2/c1-3-7-11-9(4-2)6-5-8-12-10/h5,8-9H,3-4,6-7H2,1-2H3.
What are the key properties of 4-propoxyhex-1-enyl hypofluorite?
4-propoxyhex-1-enyl hypofluorite has a molecular weight of 176.23 g/mol, XLogP of 3.00, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propoxyhex-1-enyl hypofluorite is sourced from PubChem (CID 173387860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).