C17H23N3O4 — CID 173391870
ethyl 2-[[4-[N-[(E)-but-2-enoxy]-C-methylcarbonimidoyl]phenyl]carbamoylamino]acetate (PubChem CID 173391870) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is ethyl 2-[[4-[N-[(E)-but-2-enoxy]-C-methylcarbonimidoyl]phenyl]carbamoylamino]acetate.
| Compound Name | ethyl 2-[[4-[N-[(E)-but-2-enoxy]-C-methylcarbonimidoyl]phenyl]carbamoylamino]acetate |
|---|---|
| PubChem CID | 173391870 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | ethyl 2-[[4-[N-[(E)-but-2-enoxy]-C-methylcarbonimidoyl]phenyl]carbamoylamino]acetate |
| SMILES | C/C=C/CON=C(C)c1ccc(NC(=O)NCC(=O)OCC)cc1 |
| InChI | InChI=1S/C17H23N3O4/c1-4-6-11-24-20-13(3)14-7-9-15(10-8-14)19-17(22)18-12-16(21)23-5-2/h4,6-10H,5,11-12H2,1-3H3,(H2,18,19,22)/b6-4+,20-13? |
| InChIKey | BOAQIBMORSIKLH-BTEVDIRYSA-N |
| XLogP | 2.69 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|