C15H19N3O4 — CID 173391880
prop-2-enyl 3-[[4-(N-hydroxy-C-methylcarbonimidoyl)phenyl]carbamoylamino]propanoate (PubChem CID 173391880) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is prop-2-enyl 3-[[4-(N-hydroxy-C-methylcarbonimidoyl)phenyl]carbamoylamino]propanoate.
| Compound Name | prop-2-enyl 3-[[4-(N-hydroxy-C-methylcarbonimidoyl)phenyl]carbamoylamino]propanoate |
|---|---|
| PubChem CID | 173391880 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | prop-2-enyl 3-[[4-(N-hydroxy-C-methylcarbonimidoyl)phenyl]carbamoylamino]propanoate |
| SMILES | C=CCOC(=O)CCNC(=O)Nc1ccc(C(C)=NO)cc1 |
| InChI | InChI=1S/C15H19N3O4/c1-3-10-22-14(19)8-9-16-15(20)17-13-6-4-12(5-7-13)11(2)18-21/h3-7,21H,1,8-10H2,2H3,(H2,16,17,20) |
| InChIKey | JQMBGRLKFWSTIQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|