C18H25N3O4 — CID 22154872
tert-butyl 2-[[4-[(Z)-C-methyl-N-prop-2-enoxycarbonimidoyl]phenyl]carbamoylamino]acetate (PubChem CID 22154872) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is tert-butyl 2-[[4-[(Z)-C-methyl-N-prop-2-enoxycarbonimidoyl]phenyl]carbamoylamino]acetate.
| Compound Name | tert-butyl 2-[[4-[(Z)-C-methyl-N-prop-2-enoxycarbonimidoyl]phenyl]carbamoylamino]acetate |
|---|---|
| PubChem CID | 22154872 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | tert-butyl 2-[[4-[(Z)-C-methyl-N-prop-2-enoxycarbonimidoyl]phenyl]carbamoylamino]acetate |
| SMILES | C=CCO/N=C(/C)c1ccc(NC(=O)NCC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H25N3O4/c1-6-11-24-21-13(2)14-7-9-15(10-8-14)20-17(23)19-12-16(22)25-18(3,4)5/h6-10H,1,11-12H2,2-5H3,(H2,19,20,23)/b21-13- |
| InChIKey | BPFSKSSJDVGAQV-BKUYFWCQSA-N |
| XLogP | 3.08 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|