About oxo-bis(prop-2-enoxy)-λ5-arsane
oxo-bis(prop-2-enoxy)-λ5-arsane (PubChem CID 173395449) has the molecular formula C6H11AsO3
and a molecular weight of 206.07 g/mol. Its IUPAC name is oxo-bis(prop-2-enoxy)-λ5-arsane.
Molecular Properties
| Compound Name | oxo-bis(prop-2-enoxy)-λ5-arsane |
| PubChem CID | 173395449 |
| Molecular Formula | C6H11AsO3 |
| Molecular Weight | 206.07 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | oxo-bis(prop-2-enoxy)-λ5-arsane |
| SMILES | C=CCO[AsH](=O)OCC=C |
| InChI | InChI=1S/C6H11AsO3/c1-3-5-9-7(8)10-6-4-2/h3-4,7H,1-2,5-6H2 |
| InChIKey | DGFLHFZBIPVDDJ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.07 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze oxo-bis(prop-2-enoxy)-λ5-arsane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxo-bis(prop-2-enoxy)-λ5-arsane?
The IUPAC name of oxo-bis(prop-2-enoxy)-λ5-arsane (CID 173395449) is oxo-bis(prop-2-enoxy)-λ5-arsane.
What is the SMILES notation for oxo-bis(prop-2-enoxy)-λ5-arsane?
The canonical SMILES for oxo-bis(prop-2-enoxy)-λ5-arsane is C=CCO[AsH](=O)OCC=C.
What is the InChIKey of oxo-bis(prop-2-enoxy)-λ5-arsane?
The InChIKey is DGFLHFZBIPVDDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11AsO3/c1-3-5-9-7(8)10-6-4-2/h3-4,7H,1-2,5-6H2.
What are the key properties of oxo-bis(prop-2-enoxy)-λ5-arsane?
oxo-bis(prop-2-enoxy)-λ5-arsane has a molecular weight of 206.07 g/mol, XLogP of 0.54, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxo-bis(prop-2-enoxy)-λ5-arsane is sourced from PubChem (CID 173395449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).