About bis(prop-2-enyl) carbonate;isocyanic acid
bis(prop-2-enyl) carbonate;isocyanic acid (PubChem CID 88769513) has the molecular formula C8H11NO4
and a molecular weight of 185.18 g/mol. Its IUPAC name is bis(prop-2-enyl) carbonate;isocyanic acid.
Molecular Properties
| Compound Name | bis(prop-2-enyl) carbonate;isocyanic acid |
| PubChem CID | 88769513 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | bis(prop-2-enyl) carbonate;isocyanic acid |
| SMILES | C=CCOC(=O)OCC=C.N=C=O |
| InChI | InChI=1S/C7H10O3.CHNO/c1-3-5-9-7(8)10-6-4-2;2-1-3/h3-4H,1-2,5-6H2;2H |
| InChIKey | BUAYCFVCSPSNQY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 76.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis(prop-2-enyl) carbonate;isocyanic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(prop-2-enyl) carbonate;isocyanic acid?
The IUPAC name of bis(prop-2-enyl) carbonate;isocyanic acid (CID 88769513) is bis(prop-2-enyl) carbonate;isocyanic acid.
What is the SMILES notation for bis(prop-2-enyl) carbonate;isocyanic acid?
The canonical SMILES for bis(prop-2-enyl) carbonate;isocyanic acid is C=CCOC(=O)OCC=C.N=C=O.
What is the InChIKey of bis(prop-2-enyl) carbonate;isocyanic acid?
The InChIKey is BUAYCFVCSPSNQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3.CHNO/c1-3-5-9-7(8)10-6-4-2;2-1-3/h3-4H,1-2,5-6H2;2H.
What are the key properties of bis(prop-2-enyl) carbonate;isocyanic acid?
bis(prop-2-enyl) carbonate;isocyanic acid has a molecular weight of 185.18 g/mol, XLogP of 1.41, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(prop-2-enyl) carbonate;isocyanic acid is sourced from PubChem (CID 88769513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).