About 2-hydroxybut-3-ynyl prop-2-enyl carbonate
2-hydroxybut-3-ynyl prop-2-enyl carbonate (PubChem CID 6612771) has the molecular formula C8H10O4
and a molecular weight of 170.16 g/mol. Its IUPAC name is 2-hydroxybut-3-ynyl prop-2-enyl carbonate.
Molecular Properties
| Compound Name | 2-hydroxybut-3-ynyl prop-2-enyl carbonate |
| PubChem CID | 6612771 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 2-hydroxybut-3-ynyl prop-2-enyl carbonate |
| SMILES | C#CC(O)COC(=O)OCC=C |
| InChI | InChI=1S/C8H10O4/c1-3-5-11-8(10)12-6-7(9)4-2/h2-3,7,9H,1,5-6H2 |
| InChIKey | KFFTZMFLECXNGR-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxybut-3-ynyl prop-2-enyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybut-3-ynyl prop-2-enyl carbonate?
The IUPAC name of 2-hydroxybut-3-ynyl prop-2-enyl carbonate (CID 6612771) is 2-hydroxybut-3-ynyl prop-2-enyl carbonate.
What is the SMILES notation for 2-hydroxybut-3-ynyl prop-2-enyl carbonate?
The canonical SMILES for 2-hydroxybut-3-ynyl prop-2-enyl carbonate is C#CC(O)COC(=O)OCC=C.
What is the InChIKey of 2-hydroxybut-3-ynyl prop-2-enyl carbonate?
The InChIKey is KFFTZMFLECXNGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O4/c1-3-5-11-8(10)12-6-7(9)4-2/h2-3,7,9H,1,5-6H2.
What are the key properties of 2-hydroxybut-3-ynyl prop-2-enyl carbonate?
2-hydroxybut-3-ynyl prop-2-enyl carbonate has a molecular weight of 170.16 g/mol, XLogP of 0.32, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybut-3-ynyl prop-2-enyl carbonate is sourced from PubChem (CID 6612771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).