About [5-butyl-6-[tris(trimethylsilyloxy)silylmethyl]decan-5-yl]phosphane;hydrate
[5-butyl-6-[tris(trimethylsilyloxy)silylmethyl]decan-5-yl]phosphane;hydrate (PubChem CID 173398216) has the molecular formula C24H61O4PSi4
and a molecular weight of 557.07 g/mol. Its IUPAC name is [5-butyl-6-[tris(trimethylsilyloxy)silylmethyl]decan-5-yl]phosphane;hydrate.
Molecular Properties
| Compound Name | [5-butyl-6-[tris(trimethylsilyloxy)silylmethyl]decan-5-yl]phosphane;hydrate |
| PubChem CID | 173398216 |
| Molecular Formula | C24H61O4PSi4 |
| Molecular Weight | 557.07 g/mol |
| Exact Mass | 556.34 |
| IUPAC Name | [5-butyl-6-[tris(trimethylsilyloxy)silylmethyl]decan-5-yl]phosphane;hydrate |
| SMILES | CCCCC(C[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C)C(P)(CCCC)CCCC.O |
| InChI | InChI=1S/C24H59O3PSi4.H2O/c1-13-16-19-23(24(28,20-17-14-2)21-18-15-3)22-32(25-29(4,5)6,26-30(7,8)9)27-31(10,11)12;/h23H,13-22,28H2,1-12H3;1H2 |
| InChIKey | CJYSQUUFASAQLZ-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 59.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 557.07 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [5-butyl-6-[tris(trimethylsilyloxy)silylmethyl]decan-5-yl]phosphane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-butyl-6-[tris(trimethylsilyloxy)silylmethyl]decan-5-yl]phosphane;hydrate?
The IUPAC name of [5-butyl-6-[tris(trimethylsilyloxy)silylmethyl]decan-5-yl]phosphane;hydrate (CID 173398216) is [5-butyl-6-[tris(trimethylsilyloxy)silylmethyl]decan-5-yl]phosphane;hydrate.
What is the SMILES notation for [5-butyl-6-[tris(trimethylsilyloxy)silylmethyl]decan-5-yl]phosphane;hydrate?
The canonical SMILES for [5-butyl-6-[tris(trimethylsilyloxy)silylmethyl]decan-5-yl]phosphane;hydrate is CCCCC(C[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C)C(P)(CCCC)CCCC.O.
What is the InChIKey of [5-butyl-6-[tris(trimethylsilyloxy)silylmethyl]decan-5-yl]phosphane;hydrate?
The InChIKey is CJYSQUUFASAQLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H59O3PSi4.H2O/c1-13-16-19-23(24(28,20-17-14-2)21-18-15-3)22-32(25-29(4,5)6,26-30(7,8)9)27-31(10,11)12;/h23H,13-22,28H2,1-12H3;1H2.
What are the key properties of [5-butyl-6-[tris(trimethylsilyloxy)silylmethyl]decan-5-yl]phosphane;hydrate?
[5-butyl-6-[tris(trimethylsilyloxy)silylmethyl]decan-5-yl]phosphane;hydrate has a molecular weight of 557.07 g/mol, XLogP of 8.46, 18 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-butyl-6-[tris(trimethylsilyloxy)silylmethyl]decan-5-yl]phosphane;hydrate is sourced from PubChem (CID 173398216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).