About hexanoic acid;hydride;rubidium(1+)
hexanoic acid;hydride;rubidium(1+) (PubChem CID 173400776) has the molecular formula C6H13O2Rb
and a molecular weight of 202.64 g/mol. Its IUPAC name is hexanoic acid;hydride;rubidium(1+).
Molecular Properties
| Compound Name | hexanoic acid;hydride;rubidium(1+) |
| PubChem CID | 173400776 |
| Molecular Formula | C6H13O2Rb |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.00 |
| IUPAC Name | hexanoic acid;hydride;rubidium(1+) |
| SMILES | CCCCCC(=O)O.[H-].[Rb+] |
| InChI | InChI=1S/C6H12O2.Rb.H/c1-2-3-4-5-6(7)8;;/h2-5H2,1H3,(H,7,8);;/q;+1;-1 |
| InChIKey | LCNKTTOAOMHHBN-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexanoic acid;hydride;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexanoic acid;hydride;rubidium(1+)?
The IUPAC name of hexanoic acid;hydride;rubidium(1+) (CID 173400776) is hexanoic acid;hydride;rubidium(1+).
What is the SMILES notation for hexanoic acid;hydride;rubidium(1+)?
The canonical SMILES for hexanoic acid;hydride;rubidium(1+) is CCCCCC(=O)O.[H-].[Rb+].
What is the InChIKey of hexanoic acid;hydride;rubidium(1+)?
The InChIKey is LCNKTTOAOMHHBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2.Rb.H/c1-2-3-4-5-6(7)8;;/h2-5H2,1H3,(H,7,8);;/q;+1;-1.
What are the key properties of hexanoic acid;hydride;rubidium(1+)?
hexanoic acid;hydride;rubidium(1+) has a molecular weight of 202.64 g/mol, XLogP of -1.23, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexanoic acid;hydride;rubidium(1+) is sourced from PubChem (CID 173400776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).