C15H19ClO3S — CID 173407264
2-chloro-4-oxo-3-sulfanylbut-2-enoic acid;2,2-dimethylpropylbenzene (PubChem CID 173407264) has the molecular formula C15H19ClO3S and a molecular weight of 314.83 g/mol. Its IUPAC name is 2-chloro-4-oxo-3-sulfanylbut-2-enoic acid;2,2-dimethylpropylbenzene.
| Compound Name | 2-chloro-4-oxo-3-sulfanylbut-2-enoic acid;2,2-dimethylpropylbenzene |
|---|---|
| PubChem CID | 173407264 |
| Molecular Formula | C15H19ClO3S |
| Molecular Weight | 314.83 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 2-chloro-4-oxo-3-sulfanylbut-2-enoic acid;2,2-dimethylpropylbenzene |
| SMILES | CC(C)(C)Cc1ccccc1.O=CC(S)=C(Cl)C(=O)O |
| InChI | InChI=1S/C11H16.C4H3ClO3S/c1-11(2,3)9-10-7-5-4-6-8-10;5-3(4(7)8)2(9)1-6/h4-8H,9H2,1-3H3;1,9H,(H,7,8) |
| InChIKey | MNGDADHRBXHZCV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.83 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|