C16H14N4NaO3S — CID 173407773
CID 173407773 (PubChem CID 173407773) has the molecular formula C16H14N4NaO3S and a molecular weight of 365.37 g/mol.
| Compound Name | CID 173407773 |
|---|---|
| PubChem CID | 173407773 |
| Molecular Formula | C16H14N4NaO3S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)C(Cc1nc2ccccc2[nH]1)c1nc2ccccc2[nH]1.[Na] |
| InChI | InChI=1S/C16H14N4O3S.Na/c21-24(22,23)14(16-19-12-7-3-4-8-13(12)20-16)9-15-17-10-5-1-2-6-11(10)18-15;/h1-8,14H,9H2,(H,17,18)(H,19,20)(H,21,22,23); |
| InChIKey | JBJMNBAPHMRNPU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 111.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|