C14H20N2O3S — CID 167970288
6-(1H-benzimidazol-2-ylmethylsulfonyl)hexan-1-ol (PubChem CID 167970288) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is 6-(1H-benzimidazol-2-ylmethylsulfonyl)hexan-1-ol.
| Compound Name | 6-(1H-benzimidazol-2-ylmethylsulfonyl)hexan-1-ol |
|---|---|
| PubChem CID | 167970288 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 6-(1H-benzimidazol-2-ylmethylsulfonyl)hexan-1-ol |
| SMILES | O=S(=O)(CCCCCCO)Cc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C14H20N2O3S/c17-9-5-1-2-6-10-20(18,19)11-14-15-12-7-3-4-8-13(12)16-14/h3-4,7-8,17H,1-2,5-6,9-11H2,(H,15,16) |
| InChIKey | WNBFRBDSZLJYTM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|