C16H15ClN2O3S — CID 11291055
2-(1H-benzimidazol-2-ylmethylsulfonyl)-1-(4-chlorophenyl)ethanol (PubChem CID 11291055) has the molecular formula C16H15ClN2O3S and a molecular weight of 350.83 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylmethylsulfonyl)-1-(4-chlorophenyl)ethanol.
| Compound Name | 2-(1H-benzimidazol-2-ylmethylsulfonyl)-1-(4-chlorophenyl)ethanol |
|---|---|
| PubChem CID | 11291055 |
| Molecular Formula | C16H15ClN2O3S |
| Molecular Weight | 350.83 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylmethylsulfonyl)-1-(4-chlorophenyl)ethanol |
| SMILES | O=S(=O)(Cc1nc2ccccc2[nH]1)CC(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15ClN2O3S/c17-12-7-5-11(6-8-12)15(20)9-23(21,22)10-16-18-13-3-1-2-4-14(13)19-16/h1-8,15,20H,9-10H2,(H,18,19) |
| InChIKey | RUQOUONHFGECDM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.83 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |