About trisodium;N-(1-aminobutan-2-yl)hydroxylamine;triacetate
trisodium;N-(1-aminobutan-2-yl)hydroxylamine;triacetate (PubChem CID 173409157) has the molecular formula C10H21N2Na3O7
and a molecular weight of 350.26 g/mol. Its IUPAC name is trisodium;N-(1-aminobutan-2-yl)hydroxylamine;triacetate.
Molecular Properties
| Compound Name | trisodium;N-(1-aminobutan-2-yl)hydroxylamine;triacetate |
| PubChem CID | 173409157 |
| Molecular Formula | C10H21N2Na3O7 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | trisodium;N-(1-aminobutan-2-yl)hydroxylamine;triacetate |
| SMILES | CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].CCC(CN)NO.[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C4H12N2O.3C2H4O2.3Na/c1-2-4(3-5)6-7;3*1-2(3)4;;;/h4,6-7H,2-3,5H2,1H3;3*1H3,(H,3,4);;;/q;;;;3*+1/p-3 |
| InChIKey | CVZKJUJBOVQDDR-UHFFFAOYSA-K |
| XLogP | -13.02 |
| TPSA | 178.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | -13.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze trisodium;N-(1-aminobutan-2-yl)hydroxylamine;triacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trisodium;N-(1-aminobutan-2-yl)hydroxylamine;triacetate?
The IUPAC name of trisodium;N-(1-aminobutan-2-yl)hydroxylamine;triacetate (CID 173409157) is trisodium;N-(1-aminobutan-2-yl)hydroxylamine;triacetate.
What is the SMILES notation for trisodium;N-(1-aminobutan-2-yl)hydroxylamine;triacetate?
The canonical SMILES for trisodium;N-(1-aminobutan-2-yl)hydroxylamine;triacetate is CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].CCC(CN)NO.[Na+].[Na+].[Na+].
What is the InChIKey of trisodium;N-(1-aminobutan-2-yl)hydroxylamine;triacetate?
The InChIKey is CVZKJUJBOVQDDR-UHFFFAOYSA-K. The full InChI is InChI=1S/C4H12N2O.3C2H4O2.3Na/c1-2-4(3-5)6-7;3*1-2(3)4;;;/h4,6-7H,2-3,5H2,1H3;3*1H3,(H,3,4);;;/q;;;;3*+1/p-3.
What are the key properties of trisodium;N-(1-aminobutan-2-yl)hydroxylamine;triacetate?
trisodium;N-(1-aminobutan-2-yl)hydroxylamine;triacetate has a molecular weight of 350.26 g/mol, XLogP of -13.02, 3 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for trisodium;N-(1-aminobutan-2-yl)hydroxylamine;triacetate is sourced from PubChem (CID 173409157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).