C12H24N3O10Tc — CID 173284833
ethane-1,1,2-triamine;technetium(5+);pentaacetate (PubChem CID 173284833) has the molecular formula C12H24N3O10Tc and a molecular weight of 468.34 g/mol. Its IUPAC name is ethane-1,1,2-triamine;technetium(5+);pentaacetate.
| Compound Name | ethane-1,1,2-triamine;technetium(5+);pentaacetate |
|---|---|
| PubChem CID | 173284833 |
| Molecular Formula | C12H24N3O10Tc |
| Molecular Weight | 468.34 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | ethane-1,1,2-triamine;technetium(5+);pentaacetate |
| SMILES | CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].NCC(N)N.[Tc+5] |
| InChI | InChI=1S/C2H9N3.5C2H4O2.Tc/c3-1-2(4)5;5*1-2(3)4;/h2H,1,3-5H2;5*1H3,(H,3,4);/q;;;;;;+5/p-5 |
| InChIKey | DAHHAJPBYXQWDQ-UHFFFAOYSA-I |
| XLogP | -8.03 |
| TPSA | 278.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.34 |
| LogP ≤ 5 | -8.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|