About 5,6-di(butylidene)cyclohex-2-ene-1,4-dicarboxylic acid
5,6-di(butylidene)cyclohex-2-ene-1,4-dicarboxylic acid (PubChem CID 173411397) has the molecular formula C16H22O4
and a molecular weight of 278.35 g/mol. Its IUPAC name is 5,6-di(butylidene)cyclohex-2-ene-1,4-dicarboxylic acid.
Molecular Properties
| Compound Name | 5,6-di(butylidene)cyclohex-2-ene-1,4-dicarboxylic acid |
| PubChem CID | 173411397 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 5,6-di(butylidene)cyclohex-2-ene-1,4-dicarboxylic acid |
| SMILES | CCCC=C1C(=CCCC)C(C(=O)O)C=CC1C(=O)O |
| InChI | InChI=1S/C16H22O4/c1-3-5-7-11-12(8-6-4-2)14(16(19)20)10-9-13(11)15(17)18/h7-10,13-14H,3-6H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | OKLOAJKIOHQSPO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5,6-di(butylidene)cyclohex-2-ene-1,4-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-di(butylidene)cyclohex-2-ene-1,4-dicarboxylic acid?
The IUPAC name of 5,6-di(butylidene)cyclohex-2-ene-1,4-dicarboxylic acid (CID 173411397) is 5,6-di(butylidene)cyclohex-2-ene-1,4-dicarboxylic acid.
What is the SMILES notation for 5,6-di(butylidene)cyclohex-2-ene-1,4-dicarboxylic acid?
The canonical SMILES for 5,6-di(butylidene)cyclohex-2-ene-1,4-dicarboxylic acid is CCCC=C1C(=CCCC)C(C(=O)O)C=CC1C(=O)O.
What is the InChIKey of 5,6-di(butylidene)cyclohex-2-ene-1,4-dicarboxylic acid?
The InChIKey is OKLOAJKIOHQSPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O4/c1-3-5-7-11-12(8-6-4-2)14(16(19)20)10-9-13(11)15(17)18/h7-10,13-14H,3-6H2,1-2H3,(H,17,18)(H,19,20).
What are the key properties of 5,6-di(butylidene)cyclohex-2-ene-1,4-dicarboxylic acid?
5,6-di(butylidene)cyclohex-2-ene-1,4-dicarboxylic acid has a molecular weight of 278.35 g/mol, XLogP of 3.41, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-di(butylidene)cyclohex-2-ene-1,4-dicarboxylic acid is sourced from PubChem (CID 173411397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).