About butanal;terephthalic acid
butanal;terephthalic acid (PubChem CID 174990552) has the molecular formula C12H14O5
and a molecular weight of 238.24 g/mol. Its IUPAC name is butanal;terephthalic acid.
Molecular Properties
| Compound Name | butanal;terephthalic acid |
| PubChem CID | 174990552 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | butanal;terephthalic acid |
| SMILES | CCCC=O.O=C(O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C8H6O4.C4H8O/c9-7(10)5-1-2-6(4-3-5)8(11)12;1-2-3-4-5/h1-4H,(H,9,10)(H,11,12);4H,2-3H2,1H3 |
| InChIKey | DUNQMDGHFQQQQK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze butanal;terephthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanal;terephthalic acid?
The IUPAC name of butanal;terephthalic acid (CID 174990552) is butanal;terephthalic acid.
What is the SMILES notation for butanal;terephthalic acid?
The canonical SMILES for butanal;terephthalic acid is CCCC=O.O=C(O)c1ccc(C(=O)O)cc1.
What is the InChIKey of butanal;terephthalic acid?
The InChIKey is DUNQMDGHFQQQQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O4.C4H8O/c9-7(10)5-1-2-6(4-3-5)8(11)12;1-2-3-4-5/h1-4H,(H,9,10)(H,11,12);4H,2-3H2,1H3.
What are the key properties of butanal;terephthalic acid?
butanal;terephthalic acid has a molecular weight of 238.24 g/mol, XLogP of 2.07, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butanal;terephthalic acid is sourced from PubChem (CID 174990552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).