C19H22O2 — CID 21492177
butanal;1,3-diphenylpropan-2-one (PubChem CID 21492177) has the molecular formula C19H22O2 and a molecular weight of 282.38 g/mol. Its IUPAC name is butanal;1,3-diphenylpropan-2-one.
| Compound Name | butanal;1,3-diphenylpropan-2-one |
|---|---|
| PubChem CID | 21492177 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | butanal;1,3-diphenylpropan-2-one |
| SMILES | CCCC=O.O=C(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C15H14O.C4H8O/c16-15(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14;1-2-3-4-5/h1-10H,11-12H2;4H,2-3H2,1H3 |
| InChIKey | AVIPJFQPVVGIOK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|