About 2-aminoacetic acid;butanal;methoxymethylbenzene
2-aminoacetic acid;butanal;methoxymethylbenzene (PubChem CID 155690078) has the molecular formula C14H23NO4
and a molecular weight of 269.34 g/mol. Its IUPAC name is 2-aminoacetic acid;butanal;methoxymethylbenzene.
Molecular Properties
| Compound Name | 2-aminoacetic acid;butanal;methoxymethylbenzene |
| PubChem CID | 155690078 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 2-aminoacetic acid;butanal;methoxymethylbenzene |
| SMILES | CCCC=O.COCc1ccccc1.NCC(=O)O |
| InChI | InChI=1S/C8H10O.C4H8O.C2H5NO2/c1-9-7-8-5-3-2-4-6-8;1-2-3-4-5;3-1-2(4)5/h2-6H,7H2,1H3;4H,2-3H2,1H3;1,3H2,(H,4,5) |
| InChIKey | PLIJNFFAZNCAMH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoacetic acid;butanal;methoxymethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoacetic acid;butanal;methoxymethylbenzene?
The IUPAC name of 2-aminoacetic acid;butanal;methoxymethylbenzene (CID 155690078) is 2-aminoacetic acid;butanal;methoxymethylbenzene.
What is the SMILES notation for 2-aminoacetic acid;butanal;methoxymethylbenzene?
The canonical SMILES for 2-aminoacetic acid;butanal;methoxymethylbenzene is CCCC=O.COCc1ccccc1.NCC(=O)O.
What is the InChIKey of 2-aminoacetic acid;butanal;methoxymethylbenzene?
The InChIKey is PLIJNFFAZNCAMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O.C4H8O.C2H5NO2/c1-9-7-8-5-3-2-4-6-8;1-2-3-4-5;3-1-2(4)5/h2-6H,7H2,1H3;4H,2-3H2,1H3;1,3H2,(H,4,5).
What are the key properties of 2-aminoacetic acid;butanal;methoxymethylbenzene?
2-aminoacetic acid;butanal;methoxymethylbenzene has a molecular weight of 269.34 g/mol, XLogP of 1.85, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetic acid;butanal;methoxymethylbenzene is sourced from PubChem (CID 155690078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).