About N'-hydroxyethanimidamide;hydrate
N'-hydroxyethanimidamide;hydrate (PubChem CID 173411510) has the molecular formula C2H8N2O2
and a molecular weight of 92.10 g/mol. Its IUPAC name is N'-hydroxyethanimidamide;hydrate.
Molecular Properties
| Compound Name | N'-hydroxyethanimidamide;hydrate |
| PubChem CID | 173411510 |
| Molecular Formula | C2H8N2O2 |
| Molecular Weight | 92.10 g/mol |
| Exact Mass | 92.06 |
| IUPAC Name | N'-hydroxyethanimidamide;hydrate |
| SMILES | CC(N)=NO.O |
| InChI | InChI=1S/C2H6N2O.H2O/c1-2(3)4-5;/h5H,1H3,(H2,3,4);1H2 |
| InChIKey | UOZXAYJXAWMIBZ-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 92.10 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-hydroxyethanimidamide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hydroxyethanimidamide;hydrate?
The IUPAC name of N'-hydroxyethanimidamide;hydrate (CID 173411510) is N'-hydroxyethanimidamide;hydrate.
What is the SMILES notation for N'-hydroxyethanimidamide;hydrate?
The canonical SMILES for N'-hydroxyethanimidamide;hydrate is CC(N)=NO.O.
What is the InChIKey of N'-hydroxyethanimidamide;hydrate?
The InChIKey is UOZXAYJXAWMIBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2O.H2O/c1-2(3)4-5;/h5H,1H3,(H2,3,4);1H2.
What are the key properties of N'-hydroxyethanimidamide;hydrate?
N'-hydroxyethanimidamide;hydrate has a molecular weight of 92.10 g/mol, XLogP of -1.07, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hydroxyethanimidamide;hydrate is sourced from PubChem (CID 173411510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).