C13H16N2NaO5 — CID 173425218
CID 173425218 (PubChem CID 173425218) has the molecular formula C13H16N2NaO5 and a molecular weight of 303.27 g/mol.
| Compound Name | CID 173425218 |
|---|---|
| PubChem CID | 173425218 |
| Molecular Formula | C13H16N2NaO5 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)c1ccc(C(=NO)C(=O)O)c(N)c1.[Na] |
| InChI | InChI=1S/C13H16N2O5.Na/c1-13(2,3)20-12(18)7-4-5-8(9(14)6-7)10(15-19)11(16)17;/h4-6,19H,14H2,1-3H3,(H,16,17); |
| InChIKey | QDZWIVAONXPRSH-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|