C16H16Cl2FIN2OS — CID 173426832
2-[2,4-dichloro-6-[(4-fluorophenyl)methoxy]phenyl]ethyl carbamimidothioate;hydroiodide (PubChem CID 173426832) has the molecular formula C16H16Cl2FIN2OS and a molecular weight of 501.19 g/mol. Its IUPAC name is 2-[2,4-dichloro-6-[(4-fluorophenyl)methoxy]phenyl]ethyl carbamimidothioate;hydroiodide.
| Compound Name | 2-[2,4-dichloro-6-[(4-fluorophenyl)methoxy]phenyl]ethyl carbamimidothioate;hydroiodide |
|---|---|
| PubChem CID | 173426832 |
| Molecular Formula | C16H16Cl2FIN2OS |
| Molecular Weight | 501.19 g/mol |
| Exact Mass | 499.94 |
| IUPAC Name | 2-[2,4-dichloro-6-[(4-fluorophenyl)methoxy]phenyl]ethyl carbamimidothioate;hydroiodide |
| SMILES | I.[H]/N=C(\N)SCCc1c(Cl)cc(Cl)cc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C16H15Cl2FN2OS.HI/c17-11-7-14(18)13(5-6-23-16(20)21)15(8-11)22-9-10-1-3-12(19)4-2-10;/h1-4,7-8H,5-6,9H2,(H3,20,21);1H |
| InChIKey | PAQNHGHDTLXJCE-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.19 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|