C16H14Cl2O2 — CID 14225536
3-(2,4-dichloro-6-phenylmethoxyphenyl)propanal (PubChem CID 14225536) has the molecular formula C16H14Cl2O2 and a molecular weight of 309.19 g/mol. Its IUPAC name is 3-(2,4-dichloro-6-phenylmethoxyphenyl)propanal.
| Compound Name | 3-(2,4-dichloro-6-phenylmethoxyphenyl)propanal |
|---|---|
| PubChem CID | 14225536 |
| Molecular Formula | C16H14Cl2O2 |
| Molecular Weight | 309.19 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 3-(2,4-dichloro-6-phenylmethoxyphenyl)propanal |
| SMILES | O=CCCc1c(Cl)cc(Cl)cc1OCc1ccccc1 |
| InChI | InChI=1S/C16H14Cl2O2/c17-13-9-15(18)14(7-4-8-19)16(10-13)20-11-12-5-2-1-3-6-12/h1-3,5-6,8-10H,4,7,11H2 |
| InChIKey | MVEZVQDNLZUTBR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.19 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|