About 6-thiopyran-2-ylidene-3,4-dihydro-2H-quinoline
6-thiopyran-2-ylidene-3,4-dihydro-2H-quinoline (PubChem CID 173426909) has the molecular formula C14H13NS
and a molecular weight of 227.33 g/mol. Its IUPAC name is 6-thiopyran-2-ylidene-3,4-dihydro-2H-quinoline.
Molecular Properties
| Compound Name | 6-thiopyran-2-ylidene-3,4-dihydro-2H-quinoline |
| PubChem CID | 173426909 |
| Molecular Formula | C14H13NS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 6-thiopyran-2-ylidene-3,4-dihydro-2H-quinoline |
| SMILES | C1=CSC(=c2ccc3c(c2)CCCN=3)C=C1 |
| InChI | InChI=1S/C14H13NS/c1-2-9-16-14(5-1)12-6-7-13-11(10-12)4-3-8-15-13/h1-2,5-7,9-10H,3-4,8H2 |
| InChIKey | RKDWFQATLBIZRW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-thiopyran-2-ylidene-3,4-dihydro-2H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-thiopyran-2-ylidene-3,4-dihydro-2H-quinoline?
The IUPAC name of 6-thiopyran-2-ylidene-3,4-dihydro-2H-quinoline (CID 173426909) is 6-thiopyran-2-ylidene-3,4-dihydro-2H-quinoline.
What is the SMILES notation for 6-thiopyran-2-ylidene-3,4-dihydro-2H-quinoline?
The canonical SMILES for 6-thiopyran-2-ylidene-3,4-dihydro-2H-quinoline is C1=CSC(=c2ccc3c(c2)CCCN=3)C=C1.
What is the InChIKey of 6-thiopyran-2-ylidene-3,4-dihydro-2H-quinoline?
The InChIKey is RKDWFQATLBIZRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NS/c1-2-9-16-14(5-1)12-6-7-13-11(10-12)4-3-8-15-13/h1-2,5-7,9-10H,3-4,8H2.
What are the key properties of 6-thiopyran-2-ylidene-3,4-dihydro-2H-quinoline?
6-thiopyran-2-ylidene-3,4-dihydro-2H-quinoline has a molecular weight of 227.33 g/mol, XLogP of 2.18, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-thiopyran-2-ylidene-3,4-dihydro-2H-quinoline is sourced from PubChem (CID 173426909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).