About 5a,9a,10,10a-tetrahydro-1H-thiopyrano[4,3-b]quinoline
5a,9a,10,10a-tetrahydro-1H-thiopyrano[4,3-b]quinoline (PubChem CID 57244499) has the molecular formula C12H13NS
and a molecular weight of 203.31 g/mol. Its IUPAC name is 5a,9a,10,10a-tetrahydro-1H-thiopyrano[4,3-b]quinoline.
Analyze 5a,9a,10,10a-tetrahydro-1H-thiopyrano[4,3-b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5a,9a,10,10a-tetrahydro-1H-thiopyrano[4,3-b]quinoline?
The IUPAC name of 5a,9a,10,10a-tetrahydro-1H-thiopyrano[4,3-b]quinoline (CID 57244499) is 5a,9a,10,10a-tetrahydro-1H-thiopyrano[4,3-b]quinoline.
What is the SMILES notation for 5a,9a,10,10a-tetrahydro-1H-thiopyrano[4,3-b]quinoline?
The canonical SMILES for 5a,9a,10,10a-tetrahydro-1H-thiopyrano[4,3-b]quinoline is C1=CC2CC3CSC=CC3=NC2C=C1.
What is the InChIKey of 5a,9a,10,10a-tetrahydro-1H-thiopyrano[4,3-b]quinoline?
The InChIKey is AWHZSURWRLRVLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NS/c1-2-4-11-9(3-1)7-10-8-14-6-5-12(10)13-11/h1-6,9-11H,7-8H2.
What are the key properties of 5a,9a,10,10a-tetrahydro-1H-thiopyrano[4,3-b]quinoline?
5a,9a,10,10a-tetrahydro-1H-thiopyrano[4,3-b]quinoline has a molecular weight of 203.31 g/mol, XLogP of 2.82, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5a,9a,10,10a-tetrahydro-1H-thiopyrano[4,3-b]quinoline is sourced from PubChem (CID 57244499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).