C12H15NS — CID 123451986
1-prop-2-enylsulfanyl-3,4,6,7-tetrahydroisoquinoline (PubChem CID 123451986) has the molecular formula C12H15NS and a molecular weight of 205.33 g/mol. Its IUPAC name is 1-prop-2-enylsulfanyl-3,4,6,7-tetrahydroisoquinoline.
| Compound Name | 1-prop-2-enylsulfanyl-3,4,6,7-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 123451986 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 1-prop-2-enylsulfanyl-3,4,6,7-tetrahydroisoquinoline |
| SMILES | C=CCSC1=NCCC2=CCCC=C21 |
| InChI | InChI=1S/C12H15NS/c1-2-9-14-12-11-6-4-3-5-10(11)7-8-13-12/h2,5-6H,1,3-4,7-9H2 |
| InChIKey | HMOQCJJDOZPLNA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|