C13H17NS — CID 123980966
4-ethylidene-5-prop-2-enylidene-6-prop-2-enylsulfanyl-2,3-dihydropyridine (PubChem CID 123980966) has the molecular formula C13H17NS and a molecular weight of 219.35 g/mol. Its IUPAC name is 4-ethylidene-5-prop-2-enylidene-6-prop-2-enylsulfanyl-2,3-dihydropyridine.
| Compound Name | 4-ethylidene-5-prop-2-enylidene-6-prop-2-enylsulfanyl-2,3-dihydropyridine |
|---|---|
| PubChem CID | 123980966 |
| Molecular Formula | C13H17NS |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 4-ethylidene-5-prop-2-enylidene-6-prop-2-enylsulfanyl-2,3-dihydropyridine |
| SMILES | C=CC=C1C(=CC)CCN=C1SCC=C |
| InChI | InChI=1S/C13H17NS/c1-4-7-12-11(6-3)8-9-14-13(12)15-10-5-2/h4-7H,1-2,8-10H2,3H3 |
| InChIKey | ASSFUYLMCMXKTR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|