C8H11NS — CID 91365562
4,5,6,7-tetrahydro-2H-thieno[2,3-b]azepine (PubChem CID 91365562) has the molecular formula C8H11NS and a molecular weight of 153.25 g/mol. Its IUPAC name is 4,5,6,7-tetrahydro-2H-thieno[2,3-b]azepine.
| Compound Name | 4,5,6,7-tetrahydro-2H-thieno[2,3-b]azepine |
|---|---|
| PubChem CID | 91365562 |
| Molecular Formula | C8H11NS |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | 4,5,6,7-tetrahydro-2H-thieno[2,3-b]azepine |
| SMILES | C1=C2CCCCN=C2SC1 |
| InChI | InChI=1S/C8H11NS/c1-2-5-9-8-7(3-1)4-6-10-8/h4H,1-3,5-6H2 |
| InChIKey | PSLSMAXXZYOYOL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |