C6H7F7OSi — CID 173431588
1,1,1,2,3,3,3-heptafluoropropan-2-yloxy(prop-2-enyl)silane (PubChem CID 173431588) has the molecular formula C6H7F7OSi and a molecular weight of 256.19 g/mol. Its IUPAC name is 1,1,1,2,3,3,3-heptafluoropropan-2-yloxy(prop-2-enyl)silane.
| Compound Name | 1,1,1,2,3,3,3-heptafluoropropan-2-yloxy(prop-2-enyl)silane |
|---|---|
| PubChem CID | 173431588 |
| Molecular Formula | C6H7F7OSi |
| Molecular Weight | 256.19 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 1,1,1,2,3,3,3-heptafluoropropan-2-yloxy(prop-2-enyl)silane |
| SMILES | C=CC[SiH2]OC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H7F7OSi/c1-2-3-15-14-4(7,5(8,9)10)6(11,12)13/h2H,1,3,15H2 |
| InChIKey | KEVZQUYVUAQSGZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.19 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|