C22H34OSi2 — CID 173423265
prop-2-enyl-[5-(5-prop-2-enylsilylocta-1,4,7-trien-4-yloxy)octa-1,4,7-trien-4-yl]silane (PubChem CID 173423265) has the molecular formula C22H34OSi2 and a molecular weight of 370.69 g/mol. Its IUPAC name is prop-2-enyl-[5-(5-prop-2-enylsilylocta-1,4,7-trien-4-yloxy)octa-1,4,7-trien-4-yl]silane.
| Compound Name | prop-2-enyl-[5-(5-prop-2-enylsilylocta-1,4,7-trien-4-yloxy)octa-1,4,7-trien-4-yl]silane |
|---|---|
| PubChem CID | 173423265 |
| Molecular Formula | C22H34OSi2 |
| Molecular Weight | 370.69 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | prop-2-enyl-[5-(5-prop-2-enylsilylocta-1,4,7-trien-4-yloxy)octa-1,4,7-trien-4-yl]silane |
| SMILES | C=CC[SiH2]C(CC=C)=C(CC=C)OC(CC=C)=C(CC=C)[SiH2]CC=C |
| InChI | InChI=1S/C22H34OSi2/c1-7-13-19(21(15-9-3)24-17-11-5)23-20(14-8-2)22(16-10-4)25-18-12-6/h7-12H,1-6,13-18,24-25H2 |
| InChIKey | PQGAQYXNQNUCQY-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.69 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|