C9H14F12O3Si2 — CID 173190735
bis(1,1,1,3,3,3-hexafluoropropan-2-ol);prop-2-enyl(silyloxy)silane (PubChem CID 173190735) has the molecular formula C9H14F12O3Si2 and a molecular weight of 454.36 g/mol. Its IUPAC name is bis(1,1,1,3,3,3-hexafluoropropan-2-ol);prop-2-enyl(silyloxy)silane.
| Compound Name | bis(1,1,1,3,3,3-hexafluoropropan-2-ol);prop-2-enyl(silyloxy)silane |
|---|---|
| PubChem CID | 173190735 |
| Molecular Formula | C9H14F12O3Si2 |
| Molecular Weight | 454.36 g/mol |
| Exact Mass | 454.03 |
| IUPAC Name | bis(1,1,1,3,3,3-hexafluoropropan-2-ol);prop-2-enyl(silyloxy)silane |
| SMILES | C=CC[SiH2]O[SiH3].OC(C(F)(F)F)C(F)(F)F.OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/2C3H2F6O.C3H10OSi2/c2*4-2(5,6)1(10)3(7,8)9;1-2-3-6-4-5/h2*1,10H;2H,1,3,6H2,5H3 |
| InChIKey | VBZMPFLAUIJSPR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|