C15H21N2NaO4 — CID 173434322
sodium;hydride;(2S)-2-[[(E)-4-(2-hydroxyethylamino)-4-oxobut-2-en-2-yl]amino]-3-phenylpropanoic acid (PubChem CID 173434322) has the molecular formula C15H21N2NaO4 and a molecular weight of 316.33 g/mol. Its IUPAC name is sodium;hydride;(2S)-2-[[(E)-4-(2-hydroxyethylamino)-4-oxobut-2-en-2-yl]amino]-3-phenylpropanoic acid.
| Compound Name | sodium;hydride;(2S)-2-[[(E)-4-(2-hydroxyethylamino)-4-oxobut-2-en-2-yl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 173434322 |
| Molecular Formula | C15H21N2NaO4 |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | sodium;hydride;(2S)-2-[[(E)-4-(2-hydroxyethylamino)-4-oxobut-2-en-2-yl]amino]-3-phenylpropanoic acid |
| SMILES | C/C(=C\C(=O)NCCO)N[C@@H](Cc1ccccc1)C(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C15H20N2O4.Na.H/c1-11(9-14(19)16-7-8-18)17-13(15(20)21)10-12-5-3-2-4-6-12;;/h2-6,9,13,17-18H,7-8,10H2,1H3,(H,16,19)(H,20,21);;/q;+1;-1/b11-9+;;/t13-;;/m0../s1 |
| InChIKey | FGBMPSVCNTVBMX-CXSLHNESSA-N |
| XLogP | -2.60 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|