About calcium;hydride;2-[4-(3-methylbut-2-enyl)phenyl]propanoic acid
calcium;hydride;2-[4-(3-methylbut-2-enyl)phenyl]propanoic acid (PubChem CID 173436879) has the molecular formula C14H20CaO2
and a molecular weight of 260.39 g/mol. Its IUPAC name is calcium;hydride;2-[4-(3-methylbut-2-enyl)phenyl]propanoic acid.
Molecular Properties
| Compound Name | calcium;hydride;2-[4-(3-methylbut-2-enyl)phenyl]propanoic acid |
| PubChem CID | 173436879 |
| Molecular Formula | C14H20CaO2 |
| Molecular Weight | 260.39 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | calcium;hydride;2-[4-(3-methylbut-2-enyl)phenyl]propanoic acid |
| SMILES | CC(C)=CCc1ccc(C(C)C(=O)O)cc1.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C14H18O2.Ca.2H/c1-10(2)4-5-12-6-8-13(9-7-12)11(3)14(15)16;;;/h4,6-9,11H,5H2,1-3H3,(H,15,16);;;/q;+2;2*-1 |
| InChIKey | CPHAMYPBWHLFNX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze calcium;hydride;2-[4-(3-methylbut-2-enyl)phenyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;hydride;2-[4-(3-methylbut-2-enyl)phenyl]propanoic acid?
The IUPAC name of calcium;hydride;2-[4-(3-methylbut-2-enyl)phenyl]propanoic acid (CID 173436879) is calcium;hydride;2-[4-(3-methylbut-2-enyl)phenyl]propanoic acid.
What is the SMILES notation for calcium;hydride;2-[4-(3-methylbut-2-enyl)phenyl]propanoic acid?
The canonical SMILES for calcium;hydride;2-[4-(3-methylbut-2-enyl)phenyl]propanoic acid is CC(C)=CCc1ccc(C(C)C(=O)O)cc1.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;hydride;2-[4-(3-methylbut-2-enyl)phenyl]propanoic acid?
The InChIKey is CPHAMYPBWHLFNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O2.Ca.2H/c1-10(2)4-5-12-6-8-13(9-7-12)11(3)14(15)16;;;/h4,6-9,11H,5H2,1-3H3,(H,15,16);;;/q;+2;2*-1.
What are the key properties of calcium;hydride;2-[4-(3-methylbut-2-enyl)phenyl]propanoic acid?
calcium;hydride;2-[4-(3-methylbut-2-enyl)phenyl]propanoic acid has a molecular weight of 260.39 g/mol, XLogP of 3.23, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;hydride;2-[4-(3-methylbut-2-enyl)phenyl]propanoic acid is sourced from PubChem (CID 173436879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).