C16H13NaO2S — CID 173441375
sodium;hydride;8-phenylnaphthalene-2-sulfinic acid (PubChem CID 173441375) has the molecular formula C16H13NaO2S and a molecular weight of 292.33 g/mol. Its IUPAC name is sodium;hydride;8-phenylnaphthalene-2-sulfinic acid.
| Compound Name | sodium;hydride;8-phenylnaphthalene-2-sulfinic acid |
|---|---|
| PubChem CID | 173441375 |
| Molecular Formula | C16H13NaO2S |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | sodium;hydride;8-phenylnaphthalene-2-sulfinic acid |
| SMILES | O=S(O)c1ccc2cccc(-c3ccccc3)c2c1.[H-].[Na+] |
| InChI | InChI=1S/C16H12O2S.Na.H/c17-19(18)14-10-9-13-7-4-8-15(16(13)11-14)12-5-2-1-3-6-12;;/h1-11H,(H,17,18);;/q;+1;-1 |
| InChIKey | YFTSOJJIZIHURY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|