C12H18N2O2 — CID 173442907
6-diazo-2,5-dipropoxycyclohexa-1,3-diene (PubChem CID 173442907) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 6-diazo-2,5-dipropoxycyclohexa-1,3-diene.
| Compound Name | 6-diazo-2,5-dipropoxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 173442907 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 6-diazo-2,5-dipropoxycyclohexa-1,3-diene |
| SMILES | CCCOC1=CC(=[N+]=[N-])C(OCCC)C=C1 |
| InChI | InChI=1S/C12H18N2O2/c1-3-7-15-10-5-6-12(16-8-4-2)11(9-10)14-13/h5-6,9,12H,3-4,7-8H2,1-2H3 |
| InChIKey | YPDZPFBPULTKHF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 54.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|