C20H22N4O5S3 — CID 173443610
methyl 2-[2-[3-(5-methyl-1,3,4-thiadiazol-2-yl)-3,3-bis(sulfanyl)prop-1-enyl]-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]acetate (PubChem CID 173443610) has the molecular formula C20H22N4O5S3 and a molecular weight of 494.62 g/mol. Its IUPAC name is methyl 2-[2-[3-(5-methyl-1,3,4-thiadiazol-2-yl)-3,3-bis(sulfanyl)prop-1-enyl]-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]acetate.
| Compound Name | methyl 2-[2-[3-(5-methyl-1,3,4-thiadiazol-2-yl)-3,3-bis(sulfanyl)prop-1-enyl]-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]acetate |
|---|---|
| PubChem CID | 173443610 |
| Molecular Formula | C20H22N4O5S3 |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | methyl 2-[2-[3-(5-methyl-1,3,4-thiadiazol-2-yl)-3,3-bis(sulfanyl)prop-1-enyl]-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]acetate |
| SMILES | COC(=O)CN1C(=O)C(NC(=O)COc2ccccc2)C1C=CC(S)(S)c1nnc(C)s1 |
| InChI | InChI=1S/C20H22N4O5S3/c1-12-22-23-19(32-12)20(30,31)9-8-14-17(18(27)24(14)10-16(26)28-2)21-15(25)11-29-13-6-4-3-5-7-13/h3-9,14,17,30-31H,10-11H2,1-2H3,(H,21,25) |
| InChIKey | YCIGGAYXABAYJK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|