C10H15ClN4O3 — CID 173444688
N-[4-chloro-3,3-dimethyl-4-(5-methyl-4-nitroimidazol-1-yl)butan-2-ylidene]hydroxylamine (PubChem CID 173444688) has the molecular formula C10H15ClN4O3 and a molecular weight of 274.71 g/mol. Its IUPAC name is N-[4-chloro-3,3-dimethyl-4-(5-methyl-4-nitroimidazol-1-yl)butan-2-ylidene]hydroxylamine.
| Compound Name | N-[4-chloro-3,3-dimethyl-4-(5-methyl-4-nitroimidazol-1-yl)butan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 173444688 |
| Molecular Formula | C10H15ClN4O3 |
| Molecular Weight | 274.71 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | N-[4-chloro-3,3-dimethyl-4-(5-methyl-4-nitroimidazol-1-yl)butan-2-ylidene]hydroxylamine |
| SMILES | CC(=NO)C(C)(C)C(Cl)n1cnc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C10H15ClN4O3/c1-6-8(15(17)18)12-5-14(6)9(11)10(3,4)7(2)13-16/h5,9,16H,1-4H3 |
| InChIKey | LDWSCHVPNZYQTI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.71 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|