C12H10ClN7O10 — CID 91555605
2-(4-chloro-5-methyl-3-nitropyrazol-1-yl)-3-(5-methyl-3,4-dinitropyrazol-1-yl)butanedioic acid (PubChem CID 91555605) has the molecular formula C12H10ClN7O10 and a molecular weight of 447.70 g/mol. Its IUPAC name is 2-(4-chloro-5-methyl-3-nitropyrazol-1-yl)-3-(5-methyl-3,4-dinitropyrazol-1-yl)butanedioic acid.
| Compound Name | 2-(4-chloro-5-methyl-3-nitropyrazol-1-yl)-3-(5-methyl-3,4-dinitropyrazol-1-yl)butanedioic acid |
|---|---|
| PubChem CID | 91555605 |
| Molecular Formula | C12H10ClN7O10 |
| Molecular Weight | 447.70 g/mol |
| Exact Mass | 447.02 |
| IUPAC Name | 2-(4-chloro-5-methyl-3-nitropyrazol-1-yl)-3-(5-methyl-3,4-dinitropyrazol-1-yl)butanedioic acid |
| SMILES | Cc1c(Cl)c([N+](=O)[O-])nn1C(C(=O)O)C(C(=O)O)n1nc([N+](=O)[O-])c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C12H10ClN7O10/c1-3-5(13)9(19(27)28)14-16(3)7(11(21)22)8(12(23)24)17-4(2)6(18(25)26)10(15-17)20(29)30/h7-8H,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | NSLCIDUYCPQNGW-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 239.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.70 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|