C11H23N2OPS2 — CID 173445437
N'-[butan-2-ylsulfanyl(propan-2-yloxy)phosphinothioyl]-N-prop-1-enylmethanimidamide (PubChem CID 173445437) has the molecular formula C11H23N2OPS2 and a molecular weight of 294.43 g/mol. Its IUPAC name is N'-[butan-2-ylsulfanyl(propan-2-yloxy)phosphinothioyl]-N-prop-1-enylmethanimidamide.
| Compound Name | N'-[butan-2-ylsulfanyl(propan-2-yloxy)phosphinothioyl]-N-prop-1-enylmethanimidamide |
|---|---|
| PubChem CID | 173445437 |
| Molecular Formula | C11H23N2OPS2 |
| Molecular Weight | 294.43 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | N'-[butan-2-ylsulfanyl(propan-2-yloxy)phosphinothioyl]-N-prop-1-enylmethanimidamide |
| SMILES | CC=CNC=NP(=S)(OC(C)C)SC(C)CC |
| InChI | InChI=1S/C11H23N2OPS2/c1-6-8-12-9-13-15(16,14-10(3)4)17-11(5)7-2/h6,8-11H,7H2,1-5H3,(H,12,13,16) |
| InChIKey | NENCBMGLQSHFPB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|