C10H21N2OPS2 — CID 88791482
N'-[propan-2-yloxy(propylsulfanyl)phosphinothioyl]-N-prop-1-enylmethanimidamide (PubChem CID 88791482) has the molecular formula C10H21N2OPS2 and a molecular weight of 280.40 g/mol. Its IUPAC name is N'-[propan-2-yloxy(propylsulfanyl)phosphinothioyl]-N-prop-1-enylmethanimidamide.
| Compound Name | N'-[propan-2-yloxy(propylsulfanyl)phosphinothioyl]-N-prop-1-enylmethanimidamide |
|---|---|
| PubChem CID | 88791482 |
| Molecular Formula | C10H21N2OPS2 |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | N'-[propan-2-yloxy(propylsulfanyl)phosphinothioyl]-N-prop-1-enylmethanimidamide |
| SMILES | CC=CN/C=N/P(=S)(OC(C)C)SCCC |
| InChI | InChI=1S/C10H21N2OPS2/c1-5-7-11-9-12-14(15,13-10(3)4)16-8-6-2/h5,7,9-10H,6,8H2,1-4H3,(H,11,12,15) |
| InChIKey | UJWGKDARVFPFLS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|