C22H35NO — CID 173447879
1-(2,3-diethylnaphthalen-1-yl)octan-1-amine;hydrate (PubChem CID 173447879) has the molecular formula C22H35NO and a molecular weight of 329.53 g/mol. Its IUPAC name is 1-(2,3-diethylnaphthalen-1-yl)octan-1-amine;hydrate.
| Compound Name | 1-(2,3-diethylnaphthalen-1-yl)octan-1-amine;hydrate |
|---|---|
| PubChem CID | 173447879 |
| Molecular Formula | C22H35NO |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.27 |
| IUPAC Name | 1-(2,3-diethylnaphthalen-1-yl)octan-1-amine;hydrate |
| SMILES | CCCCCCCC(N)c1c(CC)c(CC)cc2ccccc12.O |
| InChI | InChI=1S/C22H33N.H2O/c1-4-7-8-9-10-15-21(23)22-19(6-3)17(5-2)16-18-13-11-12-14-20(18)22;/h11-14,16,21H,4-10,15,23H2,1-3H3;1H2 |
| InChIKey | AMWXONADEHSORE-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 57.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|