About 1-(1-iodononyl)-2,3-dimethylnaphthalene
1-(1-iodononyl)-2,3-dimethylnaphthalene (PubChem CID 20554947) has the molecular formula C21H29I
and a molecular weight of 408.37 g/mol. Its IUPAC name is 1-(1-iodononyl)-2,3-dimethylnaphthalene.
Molecular Properties
| Compound Name | 1-(1-iodononyl)-2,3-dimethylnaphthalene |
| PubChem CID | 20554947 |
| Molecular Formula | C21H29I |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 1-(1-iodononyl)-2,3-dimethylnaphthalene |
| SMILES | CCCCCCCCC(I)c1c(C)c(C)cc2ccccc12 |
| InChI | InChI=1S/C21H29I/c1-4-5-6-7-8-9-14-20(22)21-17(3)16(2)15-18-12-10-11-13-19(18)21/h10-13,15,20H,4-9,14H2,1-3H3 |
| InChIKey | YOWIWAUPUJEMBG-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-iodononyl)-2,3-dimethylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-iodononyl)-2,3-dimethylnaphthalene?
The IUPAC name of 1-(1-iodononyl)-2,3-dimethylnaphthalene (CID 20554947) is 1-(1-iodononyl)-2,3-dimethylnaphthalene.
What is the SMILES notation for 1-(1-iodononyl)-2,3-dimethylnaphthalene?
The canonical SMILES for 1-(1-iodononyl)-2,3-dimethylnaphthalene is CCCCCCCCC(I)c1c(C)c(C)cc2ccccc12.
What is the InChIKey of 1-(1-iodononyl)-2,3-dimethylnaphthalene?
The InChIKey is YOWIWAUPUJEMBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29I/c1-4-5-6-7-8-9-14-20(22)21-17(3)16(2)15-18-12-10-11-13-19(18)21/h10-13,15,20H,4-9,14H2,1-3H3.
What are the key properties of 1-(1-iodononyl)-2,3-dimethylnaphthalene?
1-(1-iodononyl)-2,3-dimethylnaphthalene has a molecular weight of 408.37 g/mol, XLogP of 7.68, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-iodononyl)-2,3-dimethylnaphthalene is sourced from PubChem (CID 20554947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).