C21H29I — CID 20554947
1-(1-iodononyl)-2,3-dimethylnaphthalene (PubChem CID 20554947) has the molecular formula C21H29I and a molecular weight of 408.37 g/mol. Its IUPAC name is 1-(1-iodononyl)-2,3-dimethylnaphthalene.
| Compound Name | 1-(1-iodononyl)-2,3-dimethylnaphthalene |
|---|---|
| PubChem CID | 20554947 |
| Molecular Formula | C21H29I |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 1-(1-iodononyl)-2,3-dimethylnaphthalene |
| SMILES | CCCCCCCCC(I)c1c(C)c(C)cc2ccccc12 |
| InChI | InChI=1S/C21H29I/c1-4-5-6-7-8-9-14-20(22)21-17(3)16(2)15-18-12-10-11-13-19(18)21/h10-13,15,20H,4-9,14H2,1-3H3 |
| InChIKey | YOWIWAUPUJEMBG-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|