C18H32ClN — CID 173450788
1-(2,3-diethylphenyl)octan-1-amine;hydrochloride (PubChem CID 173450788) has the molecular formula C18H32ClN and a molecular weight of 297.91 g/mol. Its IUPAC name is 1-(2,3-diethylphenyl)octan-1-amine;hydrochloride.
| Compound Name | 1-(2,3-diethylphenyl)octan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 173450788 |
| Molecular Formula | C18H32ClN |
| Molecular Weight | 297.91 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | 1-(2,3-diethylphenyl)octan-1-amine;hydrochloride |
| SMILES | CCCCCCCC(N)c1cccc(CC)c1CC.Cl |
| InChI | InChI=1S/C18H31N.ClH/c1-4-7-8-9-10-14-18(19)17-13-11-12-15(5-2)16(17)6-3;/h11-13,18H,4-10,14,19H2,1-3H3;1H |
| InChIKey | PXIIGFWUTFLQDG-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.91 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|