C9H17IN2S — CID 173452158
ethyl N,N'-bis(prop-2-enyl)carbamimidothioate;hydroiodide (PubChem CID 173452158) has the molecular formula C9H17IN2S and a molecular weight of 312.22 g/mol. Its IUPAC name is ethyl N,N'-bis(prop-2-enyl)carbamimidothioate;hydroiodide.
| Compound Name | ethyl N,N'-bis(prop-2-enyl)carbamimidothioate;hydroiodide |
|---|---|
| PubChem CID | 173452158 |
| Molecular Formula | C9H17IN2S |
| Molecular Weight | 312.22 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | ethyl N,N'-bis(prop-2-enyl)carbamimidothioate;hydroiodide |
| SMILES | C=CC/N=C(/NCC=C)SCC.I |
| InChI | InChI=1S/C9H16N2S.HI/c1-4-7-10-9(12-6-3)11-8-5-2;/h4-5H,1-2,6-8H2,3H3,(H,10,11);1H |
| InChIKey | PDZSPRVBCVFAQG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.22 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|