About azane;carbamoyl(hydroxy)phosphinate;hydron
azane;carbamoyl(hydroxy)phosphinate;hydron (PubChem CID 173454240) has the molecular formula CH7N2O4P
and a molecular weight of 142.05 g/mol. Its IUPAC name is azane;carbamoyl(hydroxy)phosphinate;hydron.
Molecular Properties
| Compound Name | azane;carbamoyl(hydroxy)phosphinate;hydron |
| PubChem CID | 173454240 |
| Molecular Formula | CH7N2O4P |
| Molecular Weight | 142.05 g/mol |
| Exact Mass | 142.01 |
| IUPAC Name | azane;carbamoyl(hydroxy)phosphinate;hydron |
| SMILES | N.NC(=O)P(=O)([O-])O.[H+] |
| InChI | InChI=1S/CH4NO4P.H3N/c2-1(3)7(4,5)6;/h(H2,2,3)(H2,4,5,6);1H3 |
| InChIKey | ITQZSRIZOIRPQI-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.05 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azane;carbamoyl(hydroxy)phosphinate;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;carbamoyl(hydroxy)phosphinate;hydron?
The IUPAC name of azane;carbamoyl(hydroxy)phosphinate;hydron (CID 173454240) is azane;carbamoyl(hydroxy)phosphinate;hydron.
What is the SMILES notation for azane;carbamoyl(hydroxy)phosphinate;hydron?
The canonical SMILES for azane;carbamoyl(hydroxy)phosphinate;hydron is N.NC(=O)P(=O)([O-])O.[H+].
What is the InChIKey of azane;carbamoyl(hydroxy)phosphinate;hydron?
The InChIKey is ITQZSRIZOIRPQI-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4NO4P.H3N/c2-1(3)7(4,5)6;/h(H2,2,3)(H2,4,5,6);1H3.
What are the key properties of azane;carbamoyl(hydroxy)phosphinate;hydron?
azane;carbamoyl(hydroxy)phosphinate;hydron has a molecular weight of 142.05 g/mol, XLogP of -1.11, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;carbamoyl(hydroxy)phosphinate;hydron is sourced from PubChem (CID 173454240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).